CAS 842957-18-0 is the registry number for 2-Chloro-N-(5-methyl-benzo(1,2,5)thiadiazol-4-yl)-acetamide. Offered by: Biosynth. Available pack sizes: 50mg.
2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide (CAS 842957-18-0) is a chemical compound with the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. IUPAC name: 2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide. InChIKey: PZFSOXXVENMMMU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3OS |
|---|---|
| Molecular weight | 241.70 g/mol |
| IUPAC name | 2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide |
| InChIKey | PZFSOXXVENMMMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NSN=C2C=C1)NC(=O)CCl |
Computed by PubChem (NCBI)