Products 946744-68-9
CAS 946744-68-9 is the registry number for 7-(Chloromethyl)-2-cyclopropyl-5h-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-(chloromethyl)-2-cyclopropyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CAS 946744-68-9) is a chemical compound with the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. IUPAC name: 7-(chloromethyl)-2-cyclopropyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one. InChIKey: RZAODRKXUJHQOO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3OS |
|---|---|
| Molecular weight | 241.70 g/mol |
| IUPAC name | 7-(chloromethyl)-2-cyclopropyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | RZAODRKXUJHQOO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN3C(=O)C=C(N=C3S2)CCl |
Computed by PubChem (NCBI)