Products 554437-00-2

CAS 554437-00-2 is the registry number for 5-(Morpholine-4-sulfonyl)-2-piperidin-1-yl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoic acid (CAS 554437-00-2) is a chemical compound with the molecular formula C16H22N2O5S and a molecular weight of 354.4 g/mol. IUPAC name: 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoic acid. InChIKey: TXGMTPYEVSTAQL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O5S
Molecular weight354.4 g/mol
IUPAC name5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoic acid
InChIKeyTXGMTPYEVSTAQL-UHFFFAOYSA-N
SMILESC1CCN(CC1)C2=C(C=C(C=C2)S(=O)(=O)N3CCOCC3)C(=O)O

Computed by PubChem (NCBI)