CAS 565198-65-4 appears in our catalog under these names: 4-(4-(2,5-Dimethylbenzenesulfonyl)piperazin-1-yl)-4-oxobutanoic acid, 4-(4-[(2,5-Dimethylphenyl)sulfonyl]piperazin-1-yl)-4-oxobutanoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-oxobutanoic acid (CAS 565198-65-4) is a chemical compound with the molecular formula C16H22N2O5S and a molecular weight of 354.4 g/mol. IUPAC name: 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-oxobutanoic acid. InChIKey: CHVITORSKSQBLL-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O5S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-oxobutanoic acid |
| InChIKey | CHVITORSKSQBLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)N2CCN(CC2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)