CAS 76264-05-6 appears in our catalog under these names: Z-Ala-met-oh, 98%, Z–Ala–Met–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 5g.
(2S)-4-methylsulfanyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid (CAS 76264-05-6) is a chemical compound with the molecular formula C16H22N2O5S and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-4-methylsulfanyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid. InChIKey: YYUCTNWOJJIRAB-AAEUAGOBSA-N.
| Molecular formula | C16H22N2O5S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-4-methylsulfanyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid |
| InChIKey | YYUCTNWOJJIRAB-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)