CAS 55477-75-3 is the registry number for (2Z)-2-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-butenoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid (CAS 55477-75-3) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid. InChIKey: FHOJHXQSKYIENH-WAYWQWQTSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid |
| InChIKey | FHOJHXQSKYIENH-WAYWQWQTSA-N |
| SMILES | C/C=C(/C(=O)O)\NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)