Products 55477-75-3

CAS 55477-75-3 is the registry number for (2Z)-2-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-butenoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid (CAS 55477-75-3) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid. InChIKey: FHOJHXQSKYIENH-WAYWQWQTSA-N.

Identity
Molecular formulaC9H15NO4
Molecular weight201.22 g/mol
IUPAC name(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid
InChIKeyFHOJHXQSKYIENH-WAYWQWQTSA-N
SMILESC/C=C(/C(=O)O)\NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)