CAS 55580-07-9 appears in our catalog under these names: 4-(4-Bromophenoxy)butanoic acid, 95%, 4–(4–Bromophenoxy)butanoic acid, Butanoic acid, 4-(4-bromophenoxy)-, 96%, 96%, 4-(4-Bromophenoxy)butanoic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100g.
4-(4-bromophenoxy)butanoic acid (CAS 55580-07-9) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 4-(4-bromophenoxy)butanoic acid. InChIKey: CAYLTZLOXKEIFY-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-(4-bromophenoxy)butanoic acid |
| InChIKey | CAYLTZLOXKEIFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCC(=O)O)Br |
Computed by PubChem (NCBI)