Products 55610-00-9
CAS 55610-00-9 appears in our catalog under these names: Aristololactam II, Aristololactam II, Aristololactam II, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 5 mg, 1 mg.
3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one (CAS 55610-00-9) is a chemical compound with the molecular formula C16H9NO3 and a molecular weight of 263.25 g/mol. IUPAC name: 3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one. InChIKey: KPVDACWQNCRKTG-UHFFFAOYSA-N.
| Molecular formula | C16H9NO3 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one |
| InChIKey | KPVDACWQNCRKTG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C3=C4C(=C2)C(=O)NC4=CC5=CC=CC=C53 |
Computed by PubChem (NCBI)