Products 55666-42-7
CAS 55666-42-7 appears in our catalog under these names: tert–Butyl 2–bromobenzoate, tert-Butyl 2-bromobenzoate, tert-Butyl 2-bromobenzoate 97%, tert-Butyl 2-bromobenzoate, 97%, 97%, tert-butyl 2-bromobenzoate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 500g, 10g.
Tert-butyl 2-bromobenzoate (CAS 55666-42-7) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: tert-butyl 2-bromobenzoate. InChIKey: ZELNHJFYEDOWLF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | tert-butyl 2-bromobenzoate |
| InChIKey | ZELNHJFYEDOWLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)