Products 55674-21-0

CAS 55674-21-0 is the registry number for Methyl 2-(1-methylcyclopropyl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(1-methylcyclopropyl)-2-oxoacetate (CAS 55674-21-0) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: methyl 2-(1-methylcyclopropyl)-2-oxoacetate. InChIKey: AUGRYMFUKXDOJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O3
Molecular weight142.15 g/mol
IUPAC namemethyl 2-(1-methylcyclopropyl)-2-oxoacetate
InChIKeyAUGRYMFUKXDOJI-UHFFFAOYSA-N
SMILESCC1(CC1)C(=O)C(=O)OC

Computed by PubChem (NCBI)