Products 55697-49-9
CAS 55697-49-9 is the registry number for Methyl 2,3,6-tri-O-benzyl-α-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 5g, 1g.
(3S,4R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol (CAS 55697-49-9) is a chemical compound with the molecular formula C28H32O6 and a molecular weight of 464.5 g/mol. IUPAC name: (3S,4R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol. InChIKey: ZNKMCQRFDSVZAX-WPHWZLOXSA-N.
| Molecular formula | C28H32O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | (3S,4R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol |
| InChIKey | ZNKMCQRFDSVZAX-WPHWZLOXSA-N |
| SMILES | CO[C@@H]1C([C@@H]([C@H](C(O1)COCC2=CC=CC=C2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)