CAS 55723-45-0 appears in our catalog under these names: Z-D-Allo-ile-oh dcha, 96%, Cbz-d-allo-isoleucine, 95%, Cbz–D–allo–isoleucine, Cbz-D-Allo-Ile-OH 96%, Cbz-D-allo-isoleucine, 96%, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 25 g, 1 g, 5 g.
(2R,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 55723-45-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: JSHXJPFZKBRLFU-CMPLNLGQSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | JSHXJPFZKBRLFU-CMPLNLGQSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)