Products 55751-60-5
CAS 55751-60-5 appears in our catalog under these names: 2-(Cyclohexyloxy)benzoic acid, 95%, 2-(Cyclohexyloxy)-benzoic acid, 98%, 2-(Cyclohexyloxy)benzoic acid, 2-(Cyclohexyloxy)benzoic acid 95%, 2-(Cyclohexyloxy)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg, 500mg, 2.5g, 10g.
2-cyclohexyloxybenzoic acid (CAS 55751-60-5) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 2-cyclohexyloxybenzoic acid. InChIKey: WKZMKIVYWDNOJL-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 2-cyclohexyloxybenzoic acid |
| InChIKey | WKZMKIVYWDNOJL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)