CAS 557757-34-3 is the registry number for 6-Bromo-2,2-dimethyl-2H-chromene-5,8-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,2-dimethylchromene-5,8-dione (CAS 557757-34-3) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: 6-bromo-2,2-dimethylchromene-5,8-dione. InChIKey: QDRFEGIAXBZLQN-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 6-bromo-2,2-dimethylchromene-5,8-dione |
| InChIKey | QDRFEGIAXBZLQN-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=O)C=C(C2=O)Br)C |
Computed by PubChem (NCBI)