Products 55795-79-4
CAS 55795-79-4 is the registry number for 7,7-Dimethyl-8-oxa-1,3-diazaspiro(4.5)decane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 55795-79-4) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: 7,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: BTCYPUHMTLRQKJ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 7,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | BTCYPUHMTLRQKJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CCO1)C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)