Products 808732-87-8

CAS 808732-87-8 is the registry number for Clopidogrel Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid (CAS 808732-87-8) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid. InChIKey: LXVSWSGFEJYTPS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14ClNO2S
Molecular weight295.8 g/mol
IUPAC name2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid
InChIKeyLXVSWSGFEJYTPS-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(C(=O)O)NCCC2=CC=CS2)Cl

Computed by PubChem (NCBI)