CAS 808732-87-8 is the registry number for Clopidogrel Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid (CAS 808732-87-8) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid. InChIKey: LXVSWSGFEJYTPS-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid |
| InChIKey | LXVSWSGFEJYTPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)NCCC2=CC=CS2)Cl |
Computed by PubChem (NCBI)