Products 71796-19-5
CAS 71796-19-5 is the registry number for N-(3-Chlorophenyl)-2,5-dimethylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-chlorophenyl)-2,5-dimethylbenzenesulfonamide (CAS 71796-19-5) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: N-(3-chlorophenyl)-2,5-dimethylbenzenesulfonamide. InChIKey: XNQUMDOBRJJVEL-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2,5-dimethylbenzenesulfonamide |
| InChIKey | XNQUMDOBRJJVEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)