Products 55824-20-9
CAS 55824-20-9 appears in our catalog under these names: Abnormal Cannabidivarin, Abnormal cannabidivarin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol (CAS 55824-20-9) is a chemical compound with the molecular formula C19H26O2 and a molecular weight of 286.4 g/mol. IUPAC name: 4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol. InChIKey: CDGOSXHOMFZLSF-DLBZAZTESA-N.
| Molecular formula | C19H26O2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol |
| InChIKey | CDGOSXHOMFZLSF-DLBZAZTESA-N |
| SMILES | CCCC1=C(C(=CC(=C1)O)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C |
Computed by PubChem (NCBI)
Synonyms:
Abnormal Cannabidivarin, Abnormal CBDV