CAS 55839-51-5 is the registry number for 10-Methoxyelymoclavine. Offered by: TRC. Available pack sizes: 100mg.
[(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol (CAS 55839-51-5) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: [(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol. InChIKey: XFVXVJZNBUKGMU-WBVHZDCISA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | [(6aR,10aS)-10a-methoxy-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol |
| InChIKey | XFVXVJZNBUKGMU-WBVHZDCISA-N |
| SMILES | CN1CC(=C[C@]2([C@H]1CC3=CNC4=CC=CC2=C34)OC)CO |
Computed by PubChem (NCBI)