Products 558465-92-2
CAS 558465-92-2 appears in our catalog under these names: 3-(Bromomethyl)-N,N-dimethylbenzamide, 95%, 3-(Bromomethyl)-N,N-dimethylbenzamide, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
3-(bromomethyl)-N,N-dimethylbenzamide (CAS 558465-92-2) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 3-(bromomethyl)-N,N-dimethylbenzamide. InChIKey: IOABYEUFHYJDMN-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 3-(bromomethyl)-N,N-dimethylbenzamide |
| InChIKey | IOABYEUFHYJDMN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)CBr |
Computed by PubChem (NCBI)