CAS 5993-69-1 appears in our catalog under these names: Quinazoline-2,4(1H,3H)-dithione, 95+%, Quinazoline-2,4(1H,3H)-dithione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1H-quinazoline-2,4-dithione (CAS 5993-69-1) is a chemical compound with the molecular formula C8H6N2S2 and a molecular weight of 194.3 g/mol. IUPAC name: 1H-quinazoline-2,4-dithione. InChIKey: ZIOAGVULHUBXBS-UHFFFAOYSA-N.
| Molecular formula | C8H6N2S2 |
|---|---|
| Molecular weight | 194.3 g/mol |
| IUPAC name | 1H-quinazoline-2,4-dithione |
| InChIKey | ZIOAGVULHUBXBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=S)NC(=S)N2 |
Computed by PubChem (NCBI)