CAS 55860-35-0 appears in our catalog under these names: 4-Acetyl-2-methylbenzoic acid 97%, 4-acetyl-2-methylbenzoic acid, 97%, 97%, Fluralaner intermediate, 99.97%, 4-Acetyl-2-methylbenzoic acid, 98%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g, 1kg, 5kg.
4-acetyl-2-methylbenzoic acid (CAS 55860-35-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-acetyl-2-methylbenzoic acid. InChIKey: QGXDUDDPMXVLOO-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-acetyl-2-methylbenzoic acid |
| InChIKey | QGXDUDDPMXVLOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C)C(=O)O |
Computed by PubChem (NCBI)