CAS 55860-36-1 appears in our catalog under these names: 4-Acetyl-3-methylbenzoic acid, 95%, 4-Acetyl-3-methylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-acetyl-3-methylbenzoic acid (CAS 55860-36-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-acetyl-3-methylbenzoic acid. InChIKey: ATLFZUILURZTCQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-acetyl-3-methylbenzoic acid |
| InChIKey | ATLFZUILURZTCQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)C(=O)C |
Computed by PubChem (NCBI)