CAS 55977-10-1 appears in our catalog under these names: 3-Bromo-7-hydroxy-4-methylchromen-2-one 95%, 3-Bromo-7-hydroxy-4-methylchromen-2-one, 95%, 95%, 3-Bromo-7-hydroxy-4-methylchromen-2-one, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-bromo-7-hydroxy-4-methylchromen-2-one (CAS 55977-10-1) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 3-bromo-7-hydroxy-4-methylchromen-2-one. InChIKey: FVTBEDLKPPVXNH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 3-bromo-7-hydroxy-4-methylchromen-2-one |
| InChIKey | FVTBEDLKPPVXNH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)O)Br |
Computed by PubChem (NCBI)