CAS 560082-51-1 appears in our catalog under these names: 8-Fluoro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 97%, 8-Fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
8-fluoro-4H-1,4-benzoxazin-3-one (CAS 560082-51-1) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 8-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: DTRPZILXGOFOKO-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 8-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | DTRPZILXGOFOKO-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC=C2)F |
Computed by PubChem (NCBI)