CAS 56012-66-9 is the registry number for CRBN ligand-887. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,4-dioxo-1,3-diazinan-5-yl)urea (CAS 56012-66-9) is a chemical compound with the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. IUPAC name: (2,4-dioxo-1,3-diazinan-5-yl)urea. InChIKey: RUTLEMUBAVEUEW-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O3 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | (2,4-dioxo-1,3-diazinan-5-yl)urea |
| InChIKey | RUTLEMUBAVEUEW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC(=O)N1)NC(=O)N |
Computed by PubChem (NCBI)