CAS 56030-19-4 appears in our catalog under these names: 3-(3-Formylphenyl)propanoic acid, 95%, 3-(3-Formylphenyl)propanoic acid, 3-(3-Formylphenyl)propanoic acid 95%, 3-(3-Formylphenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg, 5g.
3-(3-formylphenyl)propanoic acid (CAS 56030-19-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-(3-formylphenyl)propanoic acid. InChIKey: ARLNATTVWKMCFT-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-(3-formylphenyl)propanoic acid |
| InChIKey | ARLNATTVWKMCFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C=O)CCC(=O)O |
Computed by PubChem (NCBI)