Products 56047-44-0
CAS 56047-44-0 is the registry number for (S)-2-Amino-5-(4-methoxyphenyl)pentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2S)-2-amino-5-(4-methoxyphenyl)pentanoic acid (CAS 56047-44-0) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: (2S)-2-amino-5-(4-methoxyphenyl)pentanoic acid. InChIKey: FCSJBORCTWILJP-NSHDSACASA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (2S)-2-amino-5-(4-methoxyphenyl)pentanoic acid |
| InChIKey | FCSJBORCTWILJP-NSHDSACASA-N |
| SMILES | COC1=CC=C(C=C1)CCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-5-(4-methoxyphenyl)pentanoic acid, Alternamic acid, Alternamic-acid, (2S)-2-amino-5-(4-methoxyphenyl)pentanoic acid, L-2-amino-5-(p-methoxyphenyl)pentanoic acid, 2-Amino-5-(4-methoxyphenyl)pentanoic acid, (S)-, (S)-2-Amino-5-(4-methoxyphenyl)pentanoicacid, (alphaS)-alpha-Amino-4-methoxybenzenepentanoic acid, Benzenepentanoic acid, alpha-amino-4-methoxy-, (S)-