CAS 56144-08-2 appears in our catalog under these names: 2-O-Methyl-β-neuraminic acid, Methylbeta-neuraminicacid, 95%, Methyl Beta-Neuraminic Acid. Offered by: MedChemExpress, Chemat Brand, TRC. Available pack sizes: 25 mg, 5 mg, on request, 25mg, 5mg.
(2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (CAS 56144-08-2) is a chemical compound with the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. IUPAC name: (2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid. InChIKey: OMVQZDUAKZZNEF-APDUKXCWSA-N.
| Molecular formula | C10H19NO8 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S,4S,5R,6R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| InChIKey | OMVQZDUAKZZNEF-APDUKXCWSA-N |
| SMILES | CO[C@]1(C[C@@H]([C@H]([C@@H](O1)[C@@H]([C@@H](CO)O)O)N)O)C(=O)O |
Computed by PubChem (NCBI)