Products 57344-93-1
CAS 57344-93-1 is the registry number for 2-O-Methyl-alpha-neuraminic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2R,4S,5R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (CAS 57344-93-1) is a chemical compound with the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. IUPAC name: (2R,4S,5R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid. InChIKey: OMVQZDUAKZZNEF-RHAHOVCOSA-N.
| Molecular formula | C10H19NO8 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2R,4S,5R)-5-amino-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| InChIKey | OMVQZDUAKZZNEF-RHAHOVCOSA-N |
| SMILES | CO[C@@]1(C[C@@H]([C@H](C(O1)[C@@H]([C@@H](CO)O)O)N)O)C(=O)O |
Computed by PubChem (NCBI)