CAS 70954-04-0 appears in our catalog under these names: N-(1-Deoxy-D-fructos-1-yl)-L-threonine, >95% (HPLC), N-(1-Deoxy-D-fructos-1-yl)-L-threonine. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 100mg.
(2S,3R)-3-hydroxy-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid (CAS 70954-04-0) is a chemical compound with the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. IUPAC name: (2S,3R)-3-hydroxy-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid. InChIKey: JDCOGXAUXWXFEG-DDIGBBAMSA-N.
| Molecular formula | C10H19NO8 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid |
| InChIKey | JDCOGXAUXWXFEG-DDIGBBAMSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)