Products 56207-20-6
CAS 56207-20-6 is the registry number for 2,6-Bis(1,1-dimethylethyl)-4-ethyl-4-hydroxy-2,5-cyclohexadien-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2,6-ditert-butyl-4-ethyl-4-hydroxycyclohexa-2,5-dien-1-one (CAS 56207-20-6) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. IUPAC name: 2,6-ditert-butyl-4-ethyl-4-hydroxycyclohexa-2,5-dien-1-one. InChIKey: SEOFAHXPAFHLNI-UHFFFAOYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-ethyl-4-hydroxycyclohexa-2,5-dien-1-one |
| InChIKey | SEOFAHXPAFHLNI-UHFFFAOYSA-N |
| SMILES | CCC1(C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C)O |
Computed by PubChem (NCBI)