CAS 56207-36-4 appears in our catalog under these names: 2'-Methyl-3'-nitroacetanilide, 95%, 2'–Methyl–3'–nitroacetanilide, 2'-Methyl-3'-nitroacetanilide, >98.0%(GC), 2'-Methyl-3'-nitroacetanilide, 98%, 98%, N-(2-methyl-3-nitrophenyl)acetamide, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
N-(2-methyl-3-nitrophenyl)acetamide (CAS 56207-36-4) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: N-(2-methyl-3-nitrophenyl)acetamide. InChIKey: NMYFXIITWKKOKY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N-(2-methyl-3-nitrophenyl)acetamide |
| InChIKey | NMYFXIITWKKOKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)