CAS 56287-73-1 appears in our catalog under these names: 2-(Fluoromethyl)-3-(2-methylphenyl)-6-nitro-3H-quinazolin-4-one, 2-(Fluoromethyl)-6-Nitro-3-(O-Tolyl)Quinazolin-4(3H)-One. Offered by: Biosynth, Chemat. Available pack sizes: 5000mg, 250mg, 1g, 5g, 25g, 10g.
2-(fluoromethyl)-3-(2-methylphenyl)-6-nitroquinazolin-4-one (CAS 56287-73-1) is a chemical compound with the molecular formula C16H12FN3O3 and a molecular weight of 313.28 g/mol. IUPAC name: 2-(fluoromethyl)-3-(2-methylphenyl)-6-nitroquinazolin-4-one. InChIKey: YLWBZTIVGRUKCL-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O3 |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | 2-(fluoromethyl)-3-(2-methylphenyl)-6-nitroquinazolin-4-one |
| InChIKey | YLWBZTIVGRUKCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=NC3=C(C2=O)C=C(C=C3)[N+](=O)[O-])CF |
Computed by PubChem (NCBI)