Products 351493-80-6
CAS 351493-80-6 is the registry number for 3-(2-(4-fluorophenoxy)acetylhydrazidyl)-2-oxoindoline. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-fluorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (CAS 351493-80-6) is a chemical compound with the molecular formula C16H12FN3O3 and a molecular weight of 313.28 g/mol. IUPAC name: 2-(4-fluorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide. InChIKey: NYQUHXDYDASCOB-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O3 |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| InChIKey | NYQUHXDYDASCOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=NC(=O)COC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)