Products 56375-83-8
CAS 56375-83-8 appears in our catalog under these names: 2-Amino-4,5-dimethylbenzenesulfonic acid, 98%, 98%, 2-Amino-4,5-dimethylbenzenesulfonic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2-amino-4,5-dimethylbenzenesulfonic acid (CAS 56375-83-8) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-amino-4,5-dimethylbenzenesulfonic acid. InChIKey: XROQUIUUGKYCQN-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-amino-4,5-dimethylbenzenesulfonic acid |
| InChIKey | XROQUIUUGKYCQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)S(=O)(=O)O)N |
Computed by PubChem (NCBI)