CAS 56433-01-3 appears in our catalog under these names: 2-(Bromomethyl)-1-chloro-3-nitrobenzene, 95%, 6–Chloro–2–nitrobenzyl bromide, 6-Chloro-2-nitrobenzyl bromide 95+%, 6-Chloro-2-nitrobenzyl bromide, 95%, 95%, 6-Chloro-2-nitrobenzyl bromide, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2-(bromomethyl)-1-chloro-3-nitrobenzene (CAS 56433-01-3) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-3-nitrobenzene. InChIKey: MAIVNONTLACJOK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-3-nitrobenzene |
| InChIKey | MAIVNONTLACJOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)