CAS 56496-89-0 is the registry number for 2,6-Dimethylbenzene-1,4-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,6-dimethylbenzene-1,4-diamine;dihydrochloride (CAS 56496-89-0) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 2,6-dimethylbenzene-1,4-diamine;dihydrochloride. InChIKey: IALKJCXEPFRYML-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 2,6-dimethylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | IALKJCXEPFRYML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)N.Cl.Cl |
Computed by PubChem (NCBI)