CAS 56520-98-0 appears in our catalog under these names: 4-ethyl-2-nitrophenol, 98+%, 98+%, 4-Ethyl-2-nitrophenol 98+%, 4–ethyl–2–nitrophenol, 4-Ethyl-2-nitrophenol, 97%. Offered by: Chemat, Ambeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500mg.
4-ethyl-2-nitrophenol (CAS 56520-98-0) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-ethyl-2-nitrophenol. InChIKey: NKWRRUKHBWTRPY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-ethyl-2-nitrophenol |
| InChIKey | NKWRRUKHBWTRPY-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)