CAS 56523-48-9 appears in our catalog under these names: (R)-2-Phenylpyrrolidine hydrochloride, 95%, (R)–2–Phenylpyrrolidine hydrochloride, (R)-2-phenylpyrrolidine hydrochloride, 95%, 95%, (R)-2-Phenylpyrrolidine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g.
(2R)-2-phenylpyrrolidine;hydrochloride (CAS 56523-48-9) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2R)-2-phenylpyrrolidine;hydrochloride. InChIKey: QVSABGBFWNYAQG-HNCPQSOCSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2R)-2-phenylpyrrolidine;hydrochloride |
| InChIKey | QVSABGBFWNYAQG-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)