CAS 565452-98-4 appears in our catalog under these names: Vildagliptin Impurity 12, Vildagliptin Impurity 57, Vildagliptin Impurity 15, Vildagliptin Impurity 19, (2R)-1-(Chloroacetyl)-2-pyrrolidinecarbonitrile, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
(2R)-1-(2-chloroacetyl)pyrrolidine-2-carbonitrile (CAS 565452-98-4) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: (2R)-1-(2-chloroacetyl)pyrrolidine-2-carbonitrile. InChIKey: YCWRPKBYQZOLCD-ZCFIWIBFSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | (2R)-1-(2-chloroacetyl)pyrrolidine-2-carbonitrile |
| InChIKey | YCWRPKBYQZOLCD-ZCFIWIBFSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)CCl)C#N |
Computed by PubChem (NCBI)