CAS 56552-80-8 appears in our catalog under these names: 3–O–Benzyl–sn–glycerol, (R)-(+)-3-Benzyloxy-1,2-propanediol, (R)-(+)-3-Benzyloxy-1,2-propanediol, >98.0%(GC), (R)-(+)-3-BENZYLOXY-1,2-PROPANEDIOL, 99%, (R)-3-(Benzyloxy)propane-1,2-diol, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 500mg, 1000mg, 100mg, 2000mg, 5000mg, 250mg.
(2R)-3-phenylmethoxypropane-1,2-diol (CAS 56552-80-8) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: (2R)-3-phenylmethoxypropane-1,2-diol. InChIKey: LWCIBYRXSHRIAP-SNVBAGLBSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (2R)-3-phenylmethoxypropane-1,2-diol |
| InChIKey | LWCIBYRXSHRIAP-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](CO)O |
Computed by PubChem (NCBI)