CAS 56594-95-7 is the registry number for 2-Amino-2,3-diphenylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2R)-2-amino-2,3-diphenylpropanoic acid (CAS 56594-95-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: (2R)-2-amino-2,3-diphenylpropanoic acid. InChIKey: YMCRTUKBQGPJNL-OAHLLOKOSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2R)-2-amino-2,3-diphenylpropanoic acid |
| InChIKey | YMCRTUKBQGPJNL-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@](C2=CC=CC=C2)(C(=O)O)N |
Computed by PubChem (NCBI)