Products 56696-00-5
CAS 56696-00-5 is the registry number for 1,5-Dimethyl-7-methylidenebicyclo(3.3.1)nonan-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-one (CAS 56696-00-5) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-one. InChIKey: LLJFLDMVLHDLKH-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-one |
| InChIKey | LLJFLDMVLHDLKH-UHFFFAOYSA-N |
| SMILES | CC12CC(=C)CC(C1)(CC(=O)C2)C |
Computed by PubChem (NCBI)