Products 5676-64-2
CAS 5676-64-2 is the registry number for (Z)-3-(4-Methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.
(Z)-3-(4-methoxyphenyl)prop-2-enoic acid (CAS 5676-64-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (Z)-3-(4-methoxyphenyl)prop-2-enoic acid. InChIKey: AFDXODALSZRGIH-DAXSKMNVSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (Z)-3-(4-methoxyphenyl)prop-2-enoic acid |
| InChIKey | AFDXODALSZRGIH-DAXSKMNVSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Methoxycinnamic acid, (Z)-, 2-Propenoic acid, 3-(4-methoxyphenyl)-, (2Z)-, (Z)-3-(4-Methoxyphenyl)acrylic acid, (Z)-p-Methoxycinnamic acid, (Z)-3-(4-methoxyphenyl)prop-2-enoic acid, 4-Methoxy-cis-cinnamic acid, (Z)-3-(4-Methoxyphenyl)acrylicacid, cis-2-Propenoic acid, 3-(4-methoxyphenyl)-, (Z)-4-methoxycinnamic acid, (Z)-p-Methoxy-cinnamic acid