Products 56774-77-7
CAS 56774-77-7 is the registry number for Morphinan-17-carboxaldehyde. Offered by: TRC. Available pack sizes: 25mg.
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carbaldehyde (CAS 56774-77-7) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carbaldehyde. InChIKey: KRKZHDBTLHCVRL-BBWFWOEESA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carbaldehyde |
| InChIKey | KRKZHDBTLHCVRL-BBWFWOEESA-N |
| SMILES | C1CC[C@@]23CCN([C@@H]([C@@H]2C1)CC4=CC=CC=C34)C=O |
Computed by PubChem (NCBI)