CAS 56816-60-5 appears in our catalog under these names: D-Abequose, >95% (HPLC), D-Abequose, D-Abequose (3,6-Dideoxy-D-xylo-hexose). Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 10mg, 2,5mg, 25mg, 50mg, on request.
(3R,5R,6R)-6-methyloxane-2,3,5-triol (CAS 56816-60-5) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (3R,5R,6R)-6-methyloxane-2,3,5-triol. InChIKey: KYPWIZMAJMNPMJ-JDJSBBGDSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (3R,5R,6R)-6-methyloxane-2,3,5-triol |
| InChIKey | KYPWIZMAJMNPMJ-JDJSBBGDSA-N |
| SMILES | C[C@@H]1[C@@H](C[C@H](C(O1)O)O)O |
Computed by PubChem (NCBI)