Products 56830-64-9
CAS 56830-64-9 appears in our catalog under these names: (±)-Benzoin-d10 (diphenyl-d10), 98 atom % D, min 98% Chemical Purity, Benzoin-d10. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2-hydroxy-1,2-bis(2,3,4,5,6-pentadeuteriophenyl)ethanone (CAS 56830-64-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 222.30 g/mol. IUPAC name: 2-hydroxy-1,2-bis(2,3,4,5,6-pentadeuteriophenyl)ethanone. InChIKey: ISAOCJYIOMOJEB-LHNTUAQVSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 222.30 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(2,3,4,5,6-pentadeuteriophenyl)ethanone |
| InChIKey | ISAOCJYIOMOJEB-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C(=O)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)