CAS 5689-59-8 appears in our catalog under these names: N-Adamantan-1-yl-2-chloro-acetamide, 95%, 1-(Chloroacetylamino) Adamantane (CAAA), N-1-Adamantyl-2-chloroacetamide. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 1g, 5g, on request, 500mg, 250mg, 1000mg, 2000mg.
N-(1-adamantyl)-2-chloroacetamide (CAS 5689-59-8) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: N-(1-adamantyl)-2-chloroacetamide. InChIKey: PJRVXDKETNCCKR-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | N-(1-adamantyl)-2-chloroacetamide |
| InChIKey | PJRVXDKETNCCKR-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)CCl |
Computed by PubChem (NCBI)