CAS 56891-69-1 is the registry number for Ethyl 3-cyano-2-mercapto-6-methylisonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Ethyl 3-cyano-6-methyl-2-sulfanylidene-1H-pyridine-4-carboxylate (CAS 56891-69-1) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: ethyl 3-cyano-6-methyl-2-sulfanylidene-1H-pyridine-4-carboxylate. InChIKey: WBMMFDGNOQLZNF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | ethyl 3-cyano-6-methyl-2-sulfanylidene-1H-pyridine-4-carboxylate |
| InChIKey | WBMMFDGNOQLZNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=S)NC(=C1)C)C#N |
Computed by PubChem (NCBI)